CAS 1016714-83-2 is the registry number for 5-Bromo-n-cyclopropyl-2-fluorobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-bromo-N-cyclopropyl-2-fluorobenzamide (CAS 1016714-83-2) is a chemical compound with the molecular formula C10H9BrFNO and a molecular weight of 258.09 g/mol. IUPAC name: 5-bromo-N-cyclopropyl-2-fluorobenzamide. InChIKey: OJVHAHRCMWTPNK-UHFFFAOYSA-N.
| Molecular formula | C10H9BrFNO |
|---|---|
| Molecular weight | 258.09 g/mol |
| IUPAC name | 5-bromo-N-cyclopropyl-2-fluorobenzamide |
| InChIKey | OJVHAHRCMWTPNK-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=C(C=CC(=C2)Br)F |
Computed by PubChem (NCBI)