CAS 1280786-54-0 is the registry number for 1-(2-Bromo-5-fluorophenyl)pyrrolidin-2-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1-(2-bromo-5-fluorophenyl)pyrrolidin-2-one (CAS 1280786-54-0) is a chemical compound with the molecular formula C10H9BrFNO and a molecular weight of 258.09 g/mol. IUPAC name: 1-(2-bromo-5-fluorophenyl)pyrrolidin-2-one. InChIKey: YIGHXLOTIFUQBV-UHFFFAOYSA-N.
| Molecular formula | C10H9BrFNO |
|---|---|
| Molecular weight | 258.09 g/mol |
| IUPAC name | 1-(2-bromo-5-fluorophenyl)pyrrolidin-2-one |
| InChIKey | YIGHXLOTIFUQBV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=C(C=CC(=C2)F)Br |
Computed by PubChem (NCBI)