CAS 2878505-75-8 is the registry number for 5-Bromo-6-fluoro-3,3-dimethylisoindolin-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-6-fluoro-3,3-dimethyl-2H-isoindol-1-one (CAS 2878505-75-8) is a chemical compound with the molecular formula C10H9BrFNO and a molecular weight of 258.09 g/mol. IUPAC name: 5-bromo-6-fluoro-3,3-dimethyl-2H-isoindol-1-one. InChIKey: DWQTVQAVEZEQJW-UHFFFAOYSA-N.
| Molecular formula | C10H9BrFNO |
|---|---|
| Molecular weight | 258.09 g/mol |
| IUPAC name | 5-bromo-6-fluoro-3,3-dimethyl-2H-isoindol-1-one |
| InChIKey | DWQTVQAVEZEQJW-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC(=C(C=C2C(=O)N1)F)Br)C |
Computed by PubChem (NCBI)