Products 1016721-78-0
CAS 1016721-78-0 appears in our catalog under these names: N-(3-[N-Hydroxyethanimidoyl]phenyl)benzamide, 95%, N-{3-(1-(Hydroxyimino)ethyl)phenyl}benzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
N-[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]benzamide (CAS 1016721-78-0) is a chemical compound with the molecular formula C15H14N2O2 and a molecular weight of 254.28 g/mol. IUPAC name: N-[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]benzamide. InChIKey: OQRLONBSUPFJKF-GZTJUZNOSA-N.
| Molecular formula | C15H14N2O2 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | N-[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]benzamide |
| InChIKey | OQRLONBSUPFJKF-GZTJUZNOSA-N |
| SMILES | C/C(=N\O)/C1=CC(=CC=C1)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)