CAS 21150-15-2 is the registry number for 1,2-Dibenzoyl-1-methylhydrazine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N'-benzoyl-N'-methylbenzohydrazide (CAS 21150-15-2) is a chemical compound with the molecular formula C15H14N2O2 and a molecular weight of 254.28 g/mol. IUPAC name: N'-benzoyl-N'-methylbenzohydrazide. InChIKey: QPHPEPMDRYADGQ-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O2 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | N'-benzoyl-N'-methylbenzohydrazide |
| InChIKey | QPHPEPMDRYADGQ-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=CC=CC=C1)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)