CAS 621-10-3 appears in our catalog under these names: Malonanilide, 95%, N1,N3-Diphenylmalonamide, 95%+, 95%+. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 100mg, 5g, 1g, 10g.
N,N'-diphenylpropanediamide (CAS 621-10-3) is a chemical compound with the molecular formula C15H14N2O2 and a molecular weight of 254.28 g/mol. IUPAC name: N,N'-diphenylpropanediamide. InChIKey: YYAQOJILQOVUSK-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O2 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | N,N'-diphenylpropanediamide |
| InChIKey | YYAQOJILQOVUSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)CC(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)