CAS 1016723-46-8 appears in our catalog under these names: 5-Amino-1-(4-chlorobenzyl)pyridin-2(1H)-one, 95%, 5-Amino-1-(4-chlorobenzyl)pyridin-2(1H)-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
5-amino-1-[(4-chlorophenyl)methyl]pyridin-2-one (CAS 1016723-46-8) is a chemical compound with the molecular formula C12H11ClN2O and a molecular weight of 234.68 g/mol. IUPAC name: 5-amino-1-[(4-chlorophenyl)methyl]pyridin-2-one. InChIKey: DEZQCQPZSAQLOG-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 5-amino-1-[(4-chlorophenyl)methyl]pyridin-2-one |
| InChIKey | DEZQCQPZSAQLOG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=C(C=CC2=O)N)Cl |
Computed by PubChem (NCBI)