CAS 1016729-35-3 appears in our catalog under these names: 3-(5-bromo-2-oxo-1,2-dihydropyridin-1-yl)propanoic acid, 3-(5-BROMO-2-OXO-1,2-DIHYDROPYRIDIN-1-YL)PROPANOIC ACID, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 250mg, 2,5g, 100mg, 1g, 5g.
3-(5-bromo-2-oxo-1-pyridinyl)propanoic acid (CAS 1016729-35-3) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 3-(5-bromo-2-oxo-1-pyridinyl)propanoic acid. InChIKey: JNSJIXFQKHIHBI-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 3-(5-bromo-2-oxo-1-pyridinyl)propanoic acid |
| InChIKey | JNSJIXFQKHIHBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C=C1Br)CCC(=O)O |
Computed by PubChem (NCBI)