Products 1016746-43-2
CAS 1016746-43-2 is the registry number for 5,6-dichloro-n-(pyridin-2-yl)pyridine-3-carboxamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5,6-dichloro-N-pyridin-2-ylpyridine-3-carboxamide (CAS 1016746-43-2) is a chemical compound with the molecular formula C11H7Cl2N3O and a molecular weight of 268.10 g/mol. IUPAC name: 5,6-dichloro-N-pyridin-2-ylpyridine-3-carboxamide. InChIKey: SRPHPZIGAOYCED-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2N3O |
|---|---|
| Molecular weight | 268.10 g/mol |
| IUPAC name | 5,6-dichloro-N-pyridin-2-ylpyridine-3-carboxamide |
| InChIKey | SRPHPZIGAOYCED-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NC(=O)C2=CC(=C(N=C2)Cl)Cl |
Computed by PubChem (NCBI)