CAS 1353505-88-0 is the registry number for 10-Chloro-2-(chloromethyl)pyrimido[1,2-b]indazol-4(6H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
10-chloro-2-(chloromethyl)-6H-pyrimido[1,2-b]indazol-4-one (CAS 1353505-88-0) is a chemical compound with the molecular formula C11H7Cl2N3O and a molecular weight of 268.10 g/mol. IUPAC name: 10-chloro-2-(chloromethyl)-6H-pyrimido[1,2-b]indazol-4-one. InChIKey: YTENGZUQTGTGOV-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2N3O |
|---|---|
| Molecular weight | 268.10 g/mol |
| IUPAC name | 10-chloro-2-(chloromethyl)-6H-pyrimido[1,2-b]indazol-4-one |
| InChIKey | YTENGZUQTGTGOV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C3=NC(=CC(=O)N3N2)CCl |
Computed by PubChem (NCBI)