Products 1416373-37-9
CAS 1416373-37-9 is the registry number for (4，6–dichloropyrimidin–5–yl)(2–methylpyridin–3–yl)methanone. Offered by: GLPBio. Available pack sizes: 200mg.
(4,6-dichloropyrimidin-5-yl)-(2-methyl-3-pyridinyl)methanone (CAS 1416373-37-9) is a chemical compound with the molecular formula C11H7Cl2N3O and a molecular weight of 268.10 g/mol. IUPAC name: (4,6-dichloropyrimidin-5-yl)-(2-methyl-3-pyridinyl)methanone. InChIKey: MOQUCAPOGBXEGO-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2N3O |
|---|---|
| Molecular weight | 268.10 g/mol |
| IUPAC name | (4,6-dichloropyrimidin-5-yl)-(2-methyl-3-pyridinyl)methanone |
| InChIKey | MOQUCAPOGBXEGO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=N1)C(=O)C2=C(N=CN=C2Cl)Cl |
Computed by PubChem (NCBI)