CAS 1016749-54-4 appears in our catalog under these names: 2-Bromo-4-fluoro-N,N-dimethylbenzamide, 2-Bromo-4-fluoro-N,N-dimethylbenzamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.
2-bromo-4-fluoro-N,N-dimethylbenzamide (CAS 1016749-54-4) is a chemical compound with the molecular formula C9H9BrFNO and a molecular weight of 246.08 g/mol. IUPAC name: 2-bromo-4-fluoro-N,N-dimethylbenzamide. InChIKey: CGUIJOTZYHWBSQ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNO |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | 2-bromo-4-fluoro-N,N-dimethylbenzamide |
| InChIKey | CGUIJOTZYHWBSQ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=C(C=C1)F)Br |
Computed by PubChem (NCBI)