CAS 1016767-95-5 appears in our catalog under these names: 3-(6-Fluoro-2,3-dioxo-2,3-dihydro-1H-indol-1-yl)propanoic acid, 95%, 3-(6-Fluoro-2,3-dioxo-2,3-dihydro-1H-indol-1-yl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-(6-fluoro-2,3-dioxoindol-1-yl)propanoic acid (CAS 1016767-95-5) is a chemical compound with the molecular formula C11H8FNO4 and a molecular weight of 237.18 g/mol. IUPAC name: 3-(6-fluoro-2,3-dioxoindol-1-yl)propanoic acid. InChIKey: NDBRGBUSAXNPBY-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO4 |
|---|---|
| Molecular weight | 237.18 g/mol |
| IUPAC name | 3-(6-fluoro-2,3-dioxoindol-1-yl)propanoic acid |
| InChIKey | NDBRGBUSAXNPBY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)N(C(=O)C2=O)CCC(=O)O |
Computed by PubChem (NCBI)