CAS 1016780-82-7 appears in our catalog under these names: Ethyl 6-bromo-4-chloro-8-methylquinoline-3-carboxylate, 98%, ethyl 6-bromo-4-chloro-8-methylquinoline-3-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 250mg, 2,5g.
Ethyl 6-bromo-4-chloro-8-methylquinoline-3-carboxylate (CAS 1016780-82-7) is a chemical compound with the molecular formula C13H11BrClNO2 and a molecular weight of 328.59 g/mol. IUPAC name: ethyl 6-bromo-4-chloro-8-methylquinoline-3-carboxylate. InChIKey: GUZLBLXLNXZMGX-UHFFFAOYSA-N.
| Molecular formula | C13H11BrClNO2 |
|---|---|
| Molecular weight | 328.59 g/mol |
| IUPAC name | ethyl 6-bromo-4-chloro-8-methylquinoline-3-carboxylate |
| InChIKey | GUZLBLXLNXZMGX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C(=CC(=CC2=C1Cl)Br)C |
Computed by PubChem (NCBI)