Products 1157726-85-6
CAS 1157726-85-6 appears in our catalog under these names: 3-Quinolinecarboxylic acid, 5-bromo-4-chloro-8-methyl-, ethyl ester, 95%, ethyl 5-bromo-4-chloro-8-methylquinoline-3-carboxylate. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g.
Ethyl 5-bromo-4-chloro-8-methylquinoline-3-carboxylate (CAS 1157726-85-6) is a chemical compound with the molecular formula C13H11BrClNO2 and a molecular weight of 328.59 g/mol. IUPAC name: ethyl 5-bromo-4-chloro-8-methylquinoline-3-carboxylate. InChIKey: USJCVDKUEBMPHX-UHFFFAOYSA-N.
| Molecular formula | C13H11BrClNO2 |
|---|---|
| Molecular weight | 328.59 g/mol |
| IUPAC name | ethyl 5-bromo-4-chloro-8-methylquinoline-3-carboxylate |
| InChIKey | USJCVDKUEBMPHX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(C=CC(=C2N=C1)C)Br)Cl |
Computed by PubChem (NCBI)