CAS 1529627-57-3 is the registry number for Ethyl 8-bromo-4-chloro-7-methylquinoline-3-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
Ethyl 8-bromo-4-chloro-7-methylquinoline-3-carboxylate (CAS 1529627-57-3) is a chemical compound with the molecular formula C13H11BrClNO2 and a molecular weight of 328.59 g/mol. IUPAC name: ethyl 8-bromo-4-chloro-7-methylquinoline-3-carboxylate. InChIKey: DKAGIUYHZICIAY-UHFFFAOYSA-N.
| Molecular formula | C13H11BrClNO2 |
|---|---|
| Molecular weight | 328.59 g/mol |
| IUPAC name | ethyl 8-bromo-4-chloro-7-methylquinoline-3-carboxylate |
| InChIKey | DKAGIUYHZICIAY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C(=C1Cl)C=CC(=C2Br)C |
Computed by PubChem (NCBI)