CAS 1016827-86-3 appears in our catalog under these names: 4-(2,2,2-Trifluoroethanesulfonyl)benzoic acid, 95%, 4-(2,2,2-Trifluoroethanesulfonyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(2,2,2-trifluoroethylsulfonyl)benzoic acid (CAS 1016827-86-3) is a chemical compound with the molecular formula C9H7F3O4S and a molecular weight of 268.21 g/mol. IUPAC name: 4-(2,2,2-trifluoroethylsulfonyl)benzoic acid. InChIKey: OOORQZCICWDOMP-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O4S |
|---|---|
| Molecular weight | 268.21 g/mol |
| IUPAC name | 4-(2,2,2-trifluoroethylsulfonyl)benzoic acid |
| InChIKey | OOORQZCICWDOMP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)S(=O)(=O)CC(F)(F)F |
Computed by PubChem (NCBI)