CAS 142994-06-7 appears in our catalog under these names: 2-(Methylsulfonyl)-4-(trifluoromethyl)benzoic acid, 98%, 2-Methylsulfonyl-4-trifluoromethylbenzoic Acid, >95% (HPLC), Isoxaflutole-benzoic acid, 2-(Methylsulfonyl)-4-(trifluoromethyl)benzoic acid, 2-(Methylsulfonyl)-4-(trifluoromethyl)benzoic acid 95%. Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, Biosynth, Ambeed. Available pack sizes: 10g, 5g, 25g, 1g, 100mg, 10mg, 25mg, 50mg.
2-methylsulfonyl-4-(trifluoromethyl)benzoic acid (CAS 142994-06-7) is a chemical compound with the molecular formula C9H7F3O4S and a molecular weight of 268.21 g/mol. IUPAC name: 2-methylsulfonyl-4-(trifluoromethyl)benzoic acid. InChIKey: OGYBDKOCZVSHQI-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O4S |
|---|---|
| Molecular weight | 268.21 g/mol |
| IUPAC name | 2-methylsulfonyl-4-(trifluoromethyl)benzoic acid |
| InChIKey | OGYBDKOCZVSHQI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)