CAS 1094264-43-3 appears in our catalog under these names: 3-(2,2,2-Trifluoroethanesulfonyl)benzoic acid, 3-(2,2,2-Trifluoroethanesulfonyl)benzoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g.
3-(2,2,2-trifluoroethylsulfonyl)benzoic acid (CAS 1094264-43-3) is a chemical compound with the molecular formula C9H7F3O4S and a molecular weight of 268.21 g/mol. IUPAC name: 3-(2,2,2-trifluoroethylsulfonyl)benzoic acid. InChIKey: LWNQKSDXFYJKOL-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O4S |
|---|---|
| Molecular weight | 268.21 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethylsulfonyl)benzoic acid |
| InChIKey | LWNQKSDXFYJKOL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)