Products 1016839-90-9
CAS 1016839-90-9 appears in our catalog under these names: 2-Methyl-4-{(1,2,4)triazolo(4,3-a)pyridin-3-yl}aniline, 95%, 2-Methyl-4-{(1,2,4)triazolo(4,3-a)pyridin-3-yl}aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-methyl-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline (CAS 1016839-90-9) is a chemical compound with the molecular formula C13H12N4 and a molecular weight of 224.26 g/mol. IUPAC name: 2-methyl-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline. InChIKey: WTOVBGFEPYHXQZ-UHFFFAOYSA-N.
| Molecular formula | C13H12N4 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 2-methyl-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline |
| InChIKey | WTOVBGFEPYHXQZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=NN=C3N2C=CC=C3)N |
Computed by PubChem (NCBI)