Products 1016865-66-9

CAS 1016865-66-9 appears in our catalog under these names: 3-(5-Methyl-2-nitrophenoxy)propanoic acid, 95%, 3-(5-Methyl-2-nitrophenoxy)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.

Structural formula: {0} (CAS {1})

3-(5-methyl-2-nitrophenoxy)propanoic acid (CAS 1016865-66-9) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: 3-(5-methyl-2-nitrophenoxy)propanoic acid. InChIKey: YPGHSCYRNRGHAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO5
Molecular weight225.20 g/mol
IUPAC name3-(5-methyl-2-nitrophenoxy)propanoic acid
InChIKeyYPGHSCYRNRGHAJ-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)[N+](=O)[O-])OCCC(=O)O

Computed by PubChem (NCBI)