CAS 1017019-26-9 appears in our catalog under these names: 3-Amino-4-methyl-n-(2,2,2-trifluoroethyl)benzamide, 95%, 3-Amino-4-methyl-N-(2,2,2-trifluoroethyl)benzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
3-amino-4-methyl-N-(2,2,2-trifluoroethyl)benzamide (CAS 1017019-26-9) is a chemical compound with the molecular formula C10H11F3N2O and a molecular weight of 232.20 g/mol. IUPAC name: 3-amino-4-methyl-N-(2,2,2-trifluoroethyl)benzamide. InChIKey: KIZCVTPSAPRUAK-UHFFFAOYSA-N.
| Molecular formula | C10H11F3N2O |
|---|---|
| Molecular weight | 232.20 g/mol |
| IUPAC name | 3-amino-4-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| InChIKey | KIZCVTPSAPRUAK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)NCC(F)(F)F)N |
Computed by PubChem (NCBI)