CAS 1174234-00-4 is the registry number for 4-Amino-n,n-dimethyl-2-(trifluoromethyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-amino-N,N-dimethyl-2-(trifluoromethyl)benzamide (CAS 1174234-00-4) is a chemical compound with the molecular formula C10H11F3N2O and a molecular weight of 232.20 g/mol. IUPAC name: 4-amino-N,N-dimethyl-2-(trifluoromethyl)benzamide. InChIKey: WSGKWCSSTYRPIE-UHFFFAOYSA-N.
| Molecular formula | C10H11F3N2O |
|---|---|
| Molecular weight | 232.20 g/mol |
| IUPAC name | 4-amino-N,N-dimethyl-2-(trifluoromethyl)benzamide |
| InChIKey | WSGKWCSSTYRPIE-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=C(C=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)