Products 1820618-84-5
CAS 1820618-84-5 is the registry number for 2-Cyclopentyl-5-(trifluoromethyl)pyrazole-3-carbaldehyde, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-cyclopentyl-3-(trifluoromethyl)pyrazole-5-carbaldehyde (CAS 1820618-84-5) is a chemical compound with the molecular formula C10H11F3N2O and a molecular weight of 232.20 g/mol. IUPAC name: 1-cyclopentyl-3-(trifluoromethyl)pyrazole-5-carbaldehyde. InChIKey: HMHRLQHAYLOAAK-UHFFFAOYSA-N.
| Molecular formula | C10H11F3N2O |
|---|---|
| Molecular weight | 232.20 g/mol |
| IUPAC name | 1-cyclopentyl-3-(trifluoromethyl)pyrazole-5-carbaldehyde |
| InChIKey | HMHRLQHAYLOAAK-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C(=CC(=N2)C(F)(F)F)C=O |
Computed by PubChem (NCBI)