CAS 1017027-77-8 appears in our catalog under these names: 2-Cyclopropylbenzo(d)oxazol-5-amine, 95+%, 2-Cyclopropyl-1,3-benzoxazol-5-amine, 2-Cyclopropylbenzo[d]oxazol-5-amine 95+%, 2-Cyclopropylbenzo[d]oxazol-5-amine, 95+%, 95+%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 2,5g, 100mg, 1g.
2-cyclopropyl-1,3-benzoxazol-5-amine (CAS 1017027-77-8) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 2-cyclopropyl-1,3-benzoxazol-5-amine. InChIKey: YDSNEXZZBXFWCT-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 2-cyclopropyl-1,3-benzoxazol-5-amine |
| InChIKey | YDSNEXZZBXFWCT-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC3=C(O2)C=CC(=C3)N |
Computed by PubChem (NCBI)