CAS 1017045-61-2 appears in our catalog under these names: 3-Cyano-N-(5-methyl-1,2-oxazol-3-yl)benzene-1-sulfonamide, 95%, 3-Cyano-N-(5-methyl-1,2-oxazol-3-yl)benzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-cyano-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide (CAS 1017045-61-2) is a chemical compound with the molecular formula C11H9N3O3S and a molecular weight of 263.27 g/mol. IUPAC name: 3-cyano-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide. InChIKey: FWNDJGHBNWRRPX-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O3S |
|---|---|
| Molecular weight | 263.27 g/mol |
| IUPAC name | 3-cyano-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
| InChIKey | FWNDJGHBNWRRPX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NS(=O)(=O)C2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)