CAS 1154306-32-7 is the registry number for 2-(N-Methyl-1,2,5-thiadiazole-3-carboxamido)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]benzoic acid (CAS 1154306-32-7) is a chemical compound with the molecular formula C11H9N3O3S and a molecular weight of 263.27 g/mol. IUPAC name: 2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]benzoic acid. InChIKey: UVJVFKINFBJQJZ-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O3S |
|---|---|
| Molecular weight | 263.27 g/mol |
| IUPAC name | 2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]benzoic acid |
| InChIKey | UVJVFKINFBJQJZ-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC=C1C(=O)O)C(=O)C2=NSN=C2 |
Computed by PubChem (NCBI)