CAS 69818-95-7 is the registry number for 2-METHYL-N-(5-NITRO-1,3-THIAZOL-2-YL)BENZAMIDE, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
2-methyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide (CAS 69818-95-7) is a chemical compound with the molecular formula C11H9N3O3S and a molecular weight of 263.27 g/mol. IUPAC name: 2-methyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide. InChIKey: SXAHCKRILHYOCW-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O3S |
|---|---|
| Molecular weight | 263.27 g/mol |
| IUPAC name | 2-methyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide |
| InChIKey | SXAHCKRILHYOCW-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)NC2=NC=C(S2)[N+](=O)[O-] |
Computed by PubChem (NCBI)