CAS 1017081-88-7 appears in our catalog under these names: (3,5-Dimethyl-4-hydroxyphenyl)acetone, 95%, (3,5-Dimethyl-4-hydroxyphenyl)acetone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
1-(4-hydroxy-3,5-dimethylphenyl)propan-2-one (CAS 1017081-88-7) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 1-(4-hydroxy-3,5-dimethylphenyl)propan-2-one. InChIKey: HRBHBDPLEAUWSQ-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 1-(4-hydroxy-3,5-dimethylphenyl)propan-2-one |
| InChIKey | HRBHBDPLEAUWSQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)C)CC(=O)C |
Computed by PubChem (NCBI)