CAS 101714-48-1 is the registry number for 4(1H)-Pyrimidinone, 2,3-dihydro-6-(3-pyridinyl)-2-thioxo-, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
6-pyridin-3-yl-2-sulfanylidene-1H-pyrimidin-4-one (CAS 101714-48-1) is a chemical compound with the molecular formula C9H7N3OS and a molecular weight of 205.24 g/mol. IUPAC name: 6-pyridin-3-yl-2-sulfanylidene-1H-pyrimidin-4-one. InChIKey: NYXRBRUQEKMUNM-UHFFFAOYSA-N.
| Molecular formula | C9H7N3OS |
|---|---|
| Molecular weight | 205.24 g/mol |
| IUPAC name | 6-pyridin-3-yl-2-sulfanylidene-1H-pyrimidin-4-one |
| InChIKey | NYXRBRUQEKMUNM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC(=O)NC(=S)N2 |
Computed by PubChem (NCBI)