CAS 69243-49-8 appears in our catalog under these names: benzo(4,5)thiazolo(2,3-c)(1,2,4)triazol-5-ylmethanol, Tricyclazole Impurity 1, 1,2,4-Triazolo(3,4-b)benzothiazole-5-methanol, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[1,2,4]triazolo[3,4-b][1,3]benzothiazol-8-ylmethanol (CAS 69243-49-8) is a chemical compound with the molecular formula C9H7N3OS and a molecular weight of 205.24 g/mol. IUPAC name: [1,2,4]triazolo[3,4-b][1,3]benzothiazol-8-ylmethanol. InChIKey: QHFZNYBHZQCEOU-UHFFFAOYSA-N.
| Molecular formula | C9H7N3OS |
|---|---|
| Molecular weight | 205.24 g/mol |
| IUPAC name | [1,2,4]triazolo[3,4-b][1,3]benzothiazol-8-ylmethanol |
| InChIKey | QHFZNYBHZQCEOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)SC3=NN=CN23)CO |
Computed by PubChem (NCBI)