CAS 447-00-7 appears in our catalog under these names: 3-Thio-6-phenyl-2h-1,2,4-triazin-5-one, 95%, 6-Phenyl-3-thio-1,2,4-triazin-5(2H)-one, 6-phenyl-3-sulfanylidene-2,3,4,5-tetrahydro-1,2,4-triazin-5-one, 98%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g.
6-phenyl-3-sulfanylidene-2H-1,2,4-triazin-5-one (CAS 447-00-7) is a chemical compound with the molecular formula C9H7N3OS and a molecular weight of 205.24 g/mol. IUPAC name: 6-phenyl-3-sulfanylidene-2H-1,2,4-triazin-5-one. InChIKey: WAQGGKJKDGJEEA-UHFFFAOYSA-N.
| Molecular formula | C9H7N3OS |
|---|---|
| Molecular weight | 205.24 g/mol |
| IUPAC name | 6-phenyl-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| InChIKey | WAQGGKJKDGJEEA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=S)NC2=O |
Computed by PubChem (NCBI)