Products 1017156-35-2
CAS 1017156-35-2 appears in our catalog under these names: Ethyl 3-(chlorosulfonyl)-2,2-dimethylpropanoate, 95%, Ethyl 3-(chlorosulfonyl)-2,2-dimethylpropanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
Ethyl 3-chlorosulfonyl-2,2-dimethylpropanoate (CAS 1017156-35-2) is a chemical compound with the molecular formula C7H13ClO4S and a molecular weight of 228.69 g/mol. IUPAC name: ethyl 3-chlorosulfonyl-2,2-dimethylpropanoate. InChIKey: QYDVIQBFRWMGLI-UHFFFAOYSA-N.
| Molecular formula | C7H13ClO4S |
|---|---|
| Molecular weight | 228.69 g/mol |
| IUPAC name | ethyl 3-chlorosulfonyl-2,2-dimethylpropanoate |
| InChIKey | QYDVIQBFRWMGLI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)