CAS 2138584-95-7 is the registry number for (6,6-Dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(6,6-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride (CAS 2138584-95-7) is a chemical compound with the molecular formula C7H13ClO4S and a molecular weight of 228.69 g/mol. IUPAC name: (6,6-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride. InChIKey: JFPWFZMMEJJFSJ-UHFFFAOYSA-N.
| Molecular formula | C7H13ClO4S |
|---|---|
| Molecular weight | 228.69 g/mol |
| IUPAC name | (6,6-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride |
| InChIKey | JFPWFZMMEJJFSJ-UHFFFAOYSA-N |
| SMILES | CC1(COCC(O1)CS(=O)(=O)Cl)C |
Computed by PubChem (NCBI)