Products 412270-38-3

CAS 412270-38-3 is the registry number for Ethyl 5-(chlorosulfonyl)pentanoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 5-chlorosulfonylpentanoate (CAS 412270-38-3) is a chemical compound with the molecular formula C7H13ClO4S and a molecular weight of 228.69 g/mol. IUPAC name: ethyl 5-chlorosulfonylpentanoate. InChIKey: QRCQAYWEVOUZLE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13ClO4S
Molecular weight228.69 g/mol
IUPAC nameethyl 5-chlorosulfonylpentanoate
InChIKeyQRCQAYWEVOUZLE-UHFFFAOYSA-N
SMILESCCOC(=O)CCCCS(=O)(=O)Cl

Computed by PubChem (NCBI)