Products 1017237-81-8
CAS 1017237-81-8 appears in our catalog under these names: Donasine, Donasine, ≥98%, ≥98%, Donasine, 95.0%. Offered by: Chemat Brand, Chemat, MedChemExpress. Available pack sizes: on request, 5mg, 10 mg, 1 mg, 5 mg.
(3S)-1-[3-[2-(dimethylamino)ethyl]-5-hydroxy-1H-indol-4-yl]-3-hydroxy-3-[2-(methylamino)ethyl]indol-2-one (CAS 1017237-81-8) is a chemical compound with the molecular formula C23H28N4O3 and a molecular weight of 408.5 g/mol. IUPAC name: (3S)-1-[3-[2-(dimethylamino)ethyl]-5-hydroxy-1H-indol-4-yl]-3-hydroxy-3-[2-(methylamino)ethyl]indol-2-one. InChIKey: BUAMVCSJOZBROF-QHCPKHFHSA-N.
| Molecular formula | C23H28N4O3 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | (3S)-1-[3-[2-(dimethylamino)ethyl]-5-hydroxy-1H-indol-4-yl]-3-hydroxy-3-[2-(methylamino)ethyl]indol-2-one |
| InChIKey | BUAMVCSJOZBROF-QHCPKHFHSA-N |
| SMILES | CNCC[C@@]1(C2=CC=CC=C2N(C1=O)C3=C(C=CC4=C3C(=CN4)CCN(C)C)O)O |
Computed by PubChem (NCBI)
Synonyms:
Donasine, orb1942233