CAS 734496-28-7 is the registry number for N-Piperidinyl Etonitazene, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
2-[(4-ethoxyphenyl)methyl]-5-nitro-1-(2-piperidin-1-ylethyl)benzimidazole (CAS 734496-28-7) is a chemical compound with the molecular formula C23H28N4O3 and a molecular weight of 408.5 g/mol. IUPAC name: 2-[(4-ethoxyphenyl)methyl]-5-nitro-1-(2-piperidin-1-ylethyl)benzimidazole. InChIKey: UMGXRAISFRUVKD-UHFFFAOYSA-N.
| Molecular formula | C23H28N4O3 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | 2-[(4-ethoxyphenyl)methyl]-5-nitro-1-(2-piperidin-1-ylethyl)benzimidazole |
| InChIKey | UMGXRAISFRUVKD-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)CC2=NC3=C(N2CCN4CCCCC4)C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)