CAS 1380413-60-4 appears in our catalog under these names: Paliperidone Impurity 4(Desfluoro Impurity), Paliperidone Impurity F, Paliperidone Desfluoro Impurity, Defluoro Paliperidone, DESFLUORO PALIPERIDONE. Offered by: Hubei YoungXin, Chemat Brand, TRC, Sigma-Aldrich, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 500mg, Get quote.
3-[2-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (CAS 1380413-60-4) is a chemical compound with the molecular formula C23H28N4O3 and a molecular weight of 408.5 g/mol. IUPAC name: 3-[2-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one. InChIKey: UAXLESNKOBLMFG-UHFFFAOYSA-N.
| Molecular formula | C23H28N4O3 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | 3-[2-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
| InChIKey | UAXLESNKOBLMFG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2CCCC(C2=N1)O)CCN3CCC(CC3)C4=NOC5=CC=CC=C54 |
Computed by PubChem (NCBI)