CAS 101724-61-2 appears in our catalog under these names: 6-Benzyloxy-5-nitroso-pyrimidine-2,4-diamine, 95%, 6–(benzyloxy)–5–nitrosopyrimidine–2,4–diamine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
5-nitroso-6-phenylmethoxypyrimidine-2,4-diamine (CAS 101724-61-2) is a chemical compound with the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. IUPAC name: 5-nitroso-6-phenylmethoxypyrimidine-2,4-diamine. InChIKey: MBQPVHNJEDDVCF-UHFFFAOYSA-N.
| Molecular formula | C11H11N5O2 |
|---|---|
| Molecular weight | 245.24 g/mol |
| IUPAC name | 5-nitroso-6-phenylmethoxypyrimidine-2,4-diamine |
| InChIKey | MBQPVHNJEDDVCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC(=NC(=C2N=O)N)N |
Computed by PubChem (NCBI)