Products 2925084-57-5
CAS 2925084-57-5 is the registry number for CRBN ligand-367. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(4-amino-1H-indazol-6-yl)-1,3-diazinane-2,4-dione (CAS 2925084-57-5) is a chemical compound with the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. IUPAC name: 1-(4-amino-1H-indazol-6-yl)-1,3-diazinane-2,4-dione. InChIKey: KBWSVNJXFKLIHR-UHFFFAOYSA-N.
| Molecular formula | C11H11N5O2 |
|---|---|
| Molecular weight | 245.24 g/mol |
| IUPAC name | 1-(4-amino-1H-indazol-6-yl)-1,3-diazinane-2,4-dione |
| InChIKey | KBWSVNJXFKLIHR-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC(=C3C=NNC3=C2)N |
Computed by PubChem (NCBI)