CAS 23120-18-5 is the registry number for N4-Benzyl-5-nitropyrimidine-4,6-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-N-benzyl-5-nitropyrimidine-4,6-diamine (CAS 23120-18-5) is a chemical compound with the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. IUPAC name: 4-N-benzyl-5-nitropyrimidine-4,6-diamine. InChIKey: XWJNZVRWZJENTG-UHFFFAOYSA-N.
| Molecular formula | C11H11N5O2 |
|---|---|
| Molecular weight | 245.24 g/mol |
| IUPAC name | 4-N-benzyl-5-nitropyrimidine-4,6-diamine |
| InChIKey | XWJNZVRWZJENTG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=NC=NC(=C2[N+](=O)[O-])N |
Computed by PubChem (NCBI)