Products 1017241-34-7
CAS 1017241-34-7 appears in our catalog under these names: (Z)-4-(4-Methylpiperazin-1-yl)-3-(2-oxopropylidene)-1H-benzo[b][1,4]diazepin-2(3H)-one, 97%, Olanzapine Ketolactam, Olanzapine Impurity J, Olanzapine Lactum, Olanzapine Impurity 6（Olanzapine EP Impurity F）. Offered by: Chemat Brand, Hubei YoungXin, TRC, TargetMol, GLPBio. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
3-[(Z)-2-hydroxyprop-1-enyl]-4-(4-methylpiperazin-1-yl)-1,5-benzodiazepin-2-one (CAS 1017241-34-7) is a chemical compound with the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. IUPAC name: 3-[(Z)-2-hydroxyprop-1-enyl]-4-(4-methylpiperazin-1-yl)-1,5-benzodiazepin-2-one. InChIKey: CVKVZGLTQPNIEY-QXMHVHEDSA-N.
| Molecular formula | C17H20N4O2 |
|---|---|
| Molecular weight | 312.37 g/mol |
| IUPAC name | 3-[(Z)-2-hydroxyprop-1-enyl]-4-(4-methylpiperazin-1-yl)-1,5-benzodiazepin-2-one |
| InChIKey | CVKVZGLTQPNIEY-QXMHVHEDSA-N |
| SMILES | C/C(=C/C1=C(N=C2C=CC=CC2=NC1=O)N3CCN(CC3)C)/O |
Computed by PubChem (NCBI)