CAS 58481-23-5 is the registry number for 7-Benzyl-3-isobutyl-1-methyl-3,7-dihydro-1H-purine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-benzyl-1-methyl-3-(2-methylpropyl)purine-2,6-dione (CAS 58481-23-5) is a chemical compound with the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. IUPAC name: 7-benzyl-1-methyl-3-(2-methylpropyl)purine-2,6-dione. InChIKey: GNMXTSLAYORZNW-UHFFFAOYSA-N.
| Molecular formula | C17H20N4O2 |
|---|---|
| Molecular weight | 312.37 g/mol |
| IUPAC name | 7-benzyl-1-methyl-3-(2-methylpropyl)purine-2,6-dione |
| InChIKey | GNMXTSLAYORZNW-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)