CAS 346704-07-2 is the registry number for N-Benzyl-2-nitro-5-piperazin-1-ylaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-benzyl-2-nitro-5-piperazin-1-ylaniline (CAS 346704-07-2) is a chemical compound with the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. IUPAC name: N-benzyl-2-nitro-5-piperazin-1-ylaniline. InChIKey: CBTLBNSQWKCFPH-UHFFFAOYSA-N.
| Molecular formula | C17H20N4O2 |
|---|---|
| Molecular weight | 312.37 g/mol |
| IUPAC name | N-benzyl-2-nitro-5-piperazin-1-ylaniline |
| InChIKey | CBTLBNSQWKCFPH-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=C(C=C2)[N+](=O)[O-])NCC3=CC=CC=C3 |
Computed by PubChem (NCBI)