Products 1017281-29-6
CAS 1017281-29-6 is the registry number for Perfluorobutanoic acid 13C4 50 µg/mL in Methanol:Water. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
2,2,3,3,4,4,4-heptafluoro(1,2,3,4-13C4)butanoic acid (CAS 1017281-29-6) is a chemical compound with the molecular formula C4HF7O2 and a molecular weight of 218.009 g/mol. IUPAC name: 2,2,3,3,4,4,4-heptafluoro(1,2,3,4-13C4)butanoic acid. InChIKey: YPJUNDFVDDCYIH-JCDJMFQYSA-N.
| Molecular formula | C4HF7O2 |
|---|---|
| Molecular weight | 218.009 g/mol |
| IUPAC name | 2,2,3,3,4,4,4-heptafluoro(1,2,3,4-13C4)butanoic acid |
| InChIKey | YPJUNDFVDDCYIH-JCDJMFQYSA-N |
| SMILES | [13C](=O)([13C]([13C]([13C](F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)