Products 335-10-4

CAS 335-10-4 is the registry number for 2,3,3,3-Tetrafluoro-2-(trifluoromethyl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoic acid (CAS 335-10-4) is a chemical compound with the molecular formula C4HF7O2 and a molecular weight of 214.04 g/mol. IUPAC name: 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoic acid. InChIKey: YJDMCDWHXOSSHI-UHFFFAOYSA-N.

Identity
Molecular formulaC4HF7O2
Molecular weight214.04 g/mol
IUPAC name2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoic acid
InChIKeyYJDMCDWHXOSSHI-UHFFFAOYSA-N
SMILESC(=O)(C(C(F)(F)F)(C(F)(F)F)F)O

Computed by PubChem (NCBI)