Products 2483735-33-5
CAS 2483735-33-5 is the registry number for Perfluorobutanoic acid 13C3 (2,3,4-13C3) 50 µg/mL in Methanol:Water. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
2,2,3,3,4,4,4-heptafluoro(2,3,4-13C3)butanoic acid (CAS 2483735-33-5) is a chemical compound with the molecular formula C4HF7O2 and a molecular weight of 217.016 g/mol. IUPAC name: 2,2,3,3,4,4,4-heptafluoro(2,3,4-13C3)butanoic acid. InChIKey: YPJUNDFVDDCYIH-VWNJCJTFSA-N.
| Molecular formula | C4HF7O2 |
|---|---|
| Molecular weight | 217.016 g/mol |
| IUPAC name | 2,2,3,3,4,4,4-heptafluoro(2,3,4-13C3)butanoic acid |
| InChIKey | YPJUNDFVDDCYIH-VWNJCJTFSA-N |
| SMILES | C(=O)([13C]([13C]([13C](F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)