CAS 101733-50-0 is the registry number for 2-(5,6,7,8-Tetrahydronaphthalen-2-yl)-1H-indole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-(5,6,7,8-tetrahydronaphthalen-2-yl)-1H-indole (CAS 101733-50-0) is a chemical compound with the molecular formula C18H17N and a molecular weight of 247.3 g/mol. IUPAC name: 2-(5,6,7,8-tetrahydronaphthalen-2-yl)-1H-indole. InChIKey: YYVRGOPIRFGDCW-UHFFFAOYSA-N.
| Molecular formula | C18H17N |
|---|---|
| Molecular weight | 247.3 g/mol |
| IUPAC name | 2-(5,6,7,8-tetrahydronaphthalen-2-yl)-1H-indole |
| InChIKey | YYVRGOPIRFGDCW-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC(=C2)C3=CC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)