Products 1268634-30-5
CAS 1268634-30-5 is the registry number for 2-(3,5-Dimethylphenyl)-4-methylquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,5-dimethylphenyl)-4-methylquinoline (CAS 1268634-30-5) is a chemical compound with the molecular formula C18H17N and a molecular weight of 247.3 g/mol. IUPAC name: 2-(3,5-dimethylphenyl)-4-methylquinoline. InChIKey: NBLLPFORLKVXEG-UHFFFAOYSA-N.
| Molecular formula | C18H17N |
|---|---|
| Molecular weight | 247.3 g/mol |
| IUPAC name | 2-(3,5-dimethylphenyl)-4-methylquinoline |
| InChIKey | NBLLPFORLKVXEG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=NC3=CC=CC=C3C(=C2)C)C |
Computed by PubChem (NCBI)