CAS 15398-00-2 is the registry number for 2,4-Di-p-tolyl-1H-pyrrole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-bis(4-methylphenyl)-1H-pyrrole (CAS 15398-00-2) is a chemical compound with the molecular formula C18H17N and a molecular weight of 247.3 g/mol. IUPAC name: 2,4-bis(4-methylphenyl)-1H-pyrrole. InChIKey: XKXLTKZRCGYWAO-UHFFFAOYSA-N.
| Molecular formula | C18H17N |
|---|---|
| Molecular weight | 247.3 g/mol |
| IUPAC name | 2,4-bis(4-methylphenyl)-1H-pyrrole |
| InChIKey | XKXLTKZRCGYWAO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=CN2)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)